C18H32N2S — CID 122424797
N-[(1E)-buta-1,3-dienyl]-N-[(1Z,3Z)-1-ethylsulfanylhexa-1,3-dien-2-yl]-N',N',2-trimethylpropane-1,3-diamine (PubChem CID 122424797) has the molecular formula C18H32N2S and a molecular weight of 308.54 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-N-[(1Z,3Z)-1-ethylsulfanylhexa-1,3-dien-2-yl]-N',N',2-trimethylpropane-1,3-diamine.
| Compound Name | N-[(1E)-buta-1,3-dienyl]-N-[(1Z,3Z)-1-ethylsulfanylhexa-1,3-dien-2-yl]-N',N',2-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 122424797 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-N-[(1Z,3Z)-1-ethylsulfanylhexa-1,3-dien-2-yl]-N',N',2-trimethylpropane-1,3-diamine |
| SMILES | C=C/C=C/N(CC(C)CN(C)C)C(/C=C\CC)=C\SCC |
| InChI | InChI=1S/C18H32N2S/c1-7-10-12-18(16-21-9-3)20(13-11-8-2)15-17(4)14-19(5)6/h8,10-13,16-17H,2,7,9,14-15H2,1,3-6H3/b12-10-,13-11+,18-16- |
| InChIKey | DXGOLVPZXBCCOM-XHYDIZAJSA-N |
| XLogP | 4.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|