C20H26N4O5 — CID 122425098
4-amino-1-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-oxo-N-(3-phenylpropyl)pyrimidine-5-carboxamide (PubChem CID 122425098) has the molecular formula C20H26N4O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-oxo-N-(3-phenylpropyl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-1-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-oxo-N-(3-phenylpropyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122425098 |
| Molecular Formula | C20H26N4O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-amino-1-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-oxo-N-(3-phenylpropyl)pyrimidine-5-carboxamide |
| SMILES | C[C@H]1C(O)[C@@H](CO)O[C@H]1n1cc(C(=O)NCCCc2ccccc2)c(N)nc1=O |
| InChI | InChI=1S/C20H26N4O5/c1-12-16(26)15(11-25)29-19(12)24-10-14(17(21)23-20(24)28)18(27)22-9-5-8-13-6-3-2-4-7-13/h2-4,6-7,10,12,15-16,19,25-26H,5,8-9,11H2,1H3,(H,22,27)(H2,21,23,28)/t12-,15+,16?,19+/m0/s1 |
| InChIKey | BBQUUHMLIKLRGB-NLURFRCDSA-N |
| XLogP | 0.07 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|