C47H34N4 — CID 122425211
9-[4-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]carbazole (PubChem CID 122425211) has the molecular formula C47H34N4 and a molecular weight of 654.82 g/mol. Its IUPAC name is 9-[4-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]carbazole.
| Compound Name | 9-[4-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 122425211 |
| Molecular Formula | C47H34N4 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 9-[4-[4-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]carbazole |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3ccc(-c4ccc(-c5ccc(-n6c7ccccc7c7ccccc76)cc5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C47H34N4/c1-31-11-15-37(16-12-31)45-48-46(38-17-13-32(2)14-18-38)50-47(49-45)39-25-23-35(24-26-39)33-19-21-34(22-20-33)36-27-29-40(30-28-36)51-43-9-5-3-7-41(43)42-8-4-6-10-44(42)51/h3-30H,1-2H3 |
| InChIKey | RUJFNLYAMSBZSF-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |