About 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole
1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole (PubChem CID 122425292) has the molecular formula C22H27NO3
and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole.
Molecular Properties
| Compound Name | 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole |
| PubChem CID | 122425292 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole |
| SMILES | CCCc1cn(CCOc2cc(C)c(OC)c(OC)c2)c2ccccc12 |
| InChI | InChI=1S/C22H27NO3/c1-5-8-17-15-23(20-10-7-6-9-19(17)20)11-12-26-18-13-16(2)22(25-4)21(14-18)24-3/h6-7,9-10,13-15H,5,8,11-12H2,1-4H3 |
| InChIKey | NYMUHGZZQKOYMT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole?
The IUPAC name of 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole (CID 122425292) is 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole.
What is the SMILES notation for 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole?
The canonical SMILES for 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole is CCCc1cn(CCOc2cc(C)c(OC)c(OC)c2)c2ccccc12.
What is the InChIKey of 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole?
The InChIKey is NYMUHGZZQKOYMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3/c1-5-8-17-15-23(20-10-7-6-9-19(17)20)11-12-26-18-13-16(2)22(25-4)21(14-18)24-3/h6-7,9-10,13-15H,5,8,11-12H2,1-4H3.
What are the key properties of 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole?
1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole has a molecular weight of 353.46 g/mol, XLogP of 5.00, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dimethoxy-5-methylphenoxy)ethyl]-3-propylindole is sourced from PubChem (CID 122425292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).