About 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole
5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole (PubChem CID 122429479) has the molecular formula C23H20N4
and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole.
Molecular Properties
| Compound Name | 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole |
| PubChem CID | 122429479 |
| Molecular Formula | C23H20N4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole |
| SMILES | CN1CNC=C1c1ccc(-c2ccc3cc(-c4cnc[nH]4)ccc3c2)cc1 |
| InChI | InChI=1S/C23H20N4/c1-27-15-25-13-23(27)17-4-2-16(3-5-17)18-6-7-20-11-21(9-8-19(20)10-18)22-12-24-14-26-22/h2-14,25H,15H2,1H3,(H,24,26) |
| InChIKey | FDHZHCUUVDROSP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole?
The IUPAC name of 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole (CID 122429479) is 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole.
What is the SMILES notation for 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole?
The canonical SMILES for 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole is CN1CNC=C1c1ccc(-c2ccc3cc(-c4cnc[nH]4)ccc3c2)cc1.
What is the InChIKey of 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole?
The InChIKey is FDHZHCUUVDROSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N4/c1-27-15-25-13-23(27)17-4-2-16(3-5-17)18-6-7-20-11-21(9-8-19(20)10-18)22-12-24-14-26-22/h2-14,25H,15H2,1H3,(H,24,26).
What are the key properties of 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole?
5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole has a molecular weight of 352.44 g/mol, XLogP of 4.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-[4-(3-methyl-1,2-dihydroimidazol-4-yl)phenyl]naphthalen-2-yl]-1H-imidazole is sourced from PubChem (CID 122429479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).