C12H21ClN2 — CID 122429537
[(4E,8E)-10-chloro-4,8-dimethyldeca-4,8-dienyl]diazene (PubChem CID 122429537) has the molecular formula C12H21ClN2 and a molecular weight of 228.77 g/mol. Its IUPAC name is [(4E,8E)-10-chloro-4,8-dimethyldeca-4,8-dienyl]diazene.
| Compound Name | [(4E,8E)-10-chloro-4,8-dimethyldeca-4,8-dienyl]diazene |
|---|---|
| PubChem CID | 122429537 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(4E,8E)-10-chloro-4,8-dimethyldeca-4,8-dienyl]diazene |
| SMILES | [H]/N=N/CCC/C(C)=C/CC/C(C)=C/CCl |
| InChI | InChI=1S/C12H21ClN2/c1-11(7-4-10-15-14)5-3-6-12(2)8-9-13/h5,8,14H,3-4,6-7,9-10H2,1-2H3/b11-5+,12-8+,15-14+ |
| InChIKey | UOWGDGQXQSQLNN-TUHPMXFSSA-N |
| XLogP | 4.71 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|