C28H50N4O6 — CID 122429909
(2S,3S)-2-[[(2S,3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-N-[(2S,3S)-1-[[(4S)-2,6-dimethyl-3-oxohept-1-en-4-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-3-methylpentanamide (PubChem CID 122429909) has the molecular formula C28H50N4O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S,3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-N-[(2S,3S)-1-[[(4S)-2,6-dimethyl-3-oxohept-1-en-4-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2S,3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-N-[(2S,3S)-1-[[(4S)-2,6-dimethyl-3-oxohept-1-en-4-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 122429909 |
| Molecular Formula | C28H50N4O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.37 |
| IUPAC Name | (2S,3S)-2-[[(2S,3S)-2-[acetyl(methyl)amino]-3-methylpentanoyl]amino]-N-[(2S,3S)-1-[[(4S)-2,6-dimethyl-3-oxohept-1-en-4-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-3-methylpentanamide |
| SMILES | C=C(C)C(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(NC(=O)[C@H]([C@@H](C)CC)N(C)C(C)=O)[C@@H](C)CC)[C@H](C)O |
| InChI | InChI=1S/C28H50N4O6/c1-12-17(7)22(30-28(38)24(18(8)13-2)32(11)20(10)34)26(36)31-23(19(9)33)27(37)29-21(14-15(3)4)25(35)16(5)6/h15,17-19,21-24,33H,5,12-14H2,1-4,6-11H3,(H,29,37)(H,30,38)(H,31,36)/t17-,18-,19-,21-,22?,23-,24-/m0/s1 |
| InChIKey | SELCWVNXDKSIJD-BPJLKQKISA-N |
| XLogP | 1.95 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|