C30H38BrN3O4 — CID 122429977
5-(5-bromo-2,4-dibutoxyphenyl)-N-ethyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-1,2-oxazole-3-carboxamide (PubChem CID 122429977) has the molecular formula C30H38BrN3O4 and a molecular weight of 584.56 g/mol. Its IUPAC name is 5-(5-bromo-2,4-dibutoxyphenyl)-N-ethyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(5-bromo-2,4-dibutoxyphenyl)-N-ethyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122429977 |
| Molecular Formula | C30H38BrN3O4 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 5-(5-bromo-2,4-dibutoxyphenyl)-N-ethyl-4-(2-methyl-3,4-dihydro-1H-isoquinolin-6-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCOc1cc(OCCCC)c(-c2onc(C(=O)NCC)c2-c2ccc3c(c2)CCN(C)C3)cc1Br |
| InChI | InChI=1S/C30H38BrN3O4/c1-5-8-14-36-25-18-26(37-15-9-6-2)24(31)17-23(25)29-27(28(33-38-29)30(35)32-7-3)21-10-11-22-19-34(4)13-12-20(22)16-21/h10-11,16-18H,5-9,12-15,19H2,1-4H3,(H,32,35) |
| InChIKey | DNYVQXRSQPIMKD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|