C33H45N3O4 — CID 122430033
5-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-7-yl)-1,2-oxazole-3-carboxamide (PubChem CID 122430033) has the molecular formula C33H45N3O4 and a molecular weight of 547.74 g/mol. Its IUPAC name is 5-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-7-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-7-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122430033 |
| Molecular Formula | C33H45N3O4 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | 5-(2,4-dibutoxy-5-propan-2-ylphenyl)-N-ethyl-4-(2,3,4,5-tetrahydro-1H-2-benzazepin-7-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCOc1cc(OCCCC)c(C(C)C)cc1-c1onc(C(=O)NCC)c1-c1ccc2c(c1)CCCNC2 |
| InChI | InChI=1S/C33H45N3O4/c1-6-9-16-38-28-20-29(39-17-10-7-2)27(19-26(28)22(4)5)32-30(31(36-40-32)33(37)35-8-3)24-13-14-25-21-34-15-11-12-23(25)18-24/h13-14,18-20,22,34H,6-12,15-17,21H2,1-5H3,(H,35,37) |
| InChIKey | PNBVTCQDWJQURE-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|