About (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine
(2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine (PubChem CID 122431049) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine |
| PubChem CID | 122431049 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine |
| SMILES | C/C=C\C(=C/C=N/CC)NC |
| InChI | InChI=1S/C9H16N2/c1-4-6-9(10-3)7-8-11-5-2/h4,6-8,10H,5H2,1-3H3/b6-4-,9-7+,11-8+ |
| InChIKey | QCBJJUMDUNWYQZ-FWHLFXCYSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine?
The IUPAC name of (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine (CID 122431049) is (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine.
What is the SMILES notation for (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine?
The canonical SMILES for (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine is C/C=C\C(=C/C=N/CC)NC.
What is the InChIKey of (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine?
The InChIKey is QCBJJUMDUNWYQZ-FWHLFXCYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-6-9(10-3)7-8-11-5-2/h4,6-8,10H,5H2,1-3H3/b6-4-,9-7+,11-8+.
What are the key properties of (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine?
(2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine has a molecular weight of 152.24 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-1-ethylimino-N-methylhexa-2,4-dien-3-amine is sourced from PubChem (CID 122431049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).