About 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole
9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole (PubChem CID 122431292) has the molecular formula C22H15F6NO2
and a molecular weight of 439.36 g/mol. Its IUPAC name is 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole.
Molecular Properties
| Compound Name | 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole |
| PubChem CID | 122431292 |
| Molecular Formula | C22H15F6NO2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole |
| SMILES | COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H15F6NO2/c1-30-13-4-7-18-15(10-13)16-11-14(31-2)5-8-19(16)29(18)20-6-3-12(21(23,24)25)9-17(20)22(26,27)28/h3-11H,1-2H3 |
| InChIKey | HGELFWASHDONRX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole?
The IUPAC name of 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole (CID 122431292) is 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole.
What is the SMILES notation for 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole?
The canonical SMILES for 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole is COc1ccc2c(c1)c1cc(OC)ccc1n2-c1ccc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole?
The InChIKey is HGELFWASHDONRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F6NO2/c1-30-13-4-7-18-15(10-13)16-11-14(31-2)5-8-19(16)29(18)20-6-3-12(21(23,24)25)9-17(20)22(26,27)28/h3-11H,1-2H3.
What are the key properties of 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole?
9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole has a molecular weight of 439.36 g/mol, XLogP of 6.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2,4-bis(trifluoromethyl)phenyl]-3,6-dimethoxycarbazole is sourced from PubChem (CID 122431292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).