C26H24N6O4 — CID 122431426
4-(2-methoxyethoxy)-2-(2-methoxy-4-pyridinyl)-N-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)quinoline-7-carboxamide (PubChem CID 122431426) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-2-(2-methoxy-4-pyridinyl)-N-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)quinoline-7-carboxamide.
| Compound Name | 4-(2-methoxyethoxy)-2-(2-methoxy-4-pyridinyl)-N-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431426 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 4-(2-methoxyethoxy)-2-(2-methoxy-4-pyridinyl)-N-([1,2,4]triazolo[1,5-a]pyridin-7-ylmethyl)quinoline-7-carboxamide |
| SMILES | COCCOc1cc(-c2ccnc(OC)c2)nc2cc(C(=O)NCc3ccn4ncnc4c3)ccc12 |
| InChI | InChI=1S/C26H24N6O4/c1-34-9-10-36-23-14-21(18-5-7-27-25(13-18)35-2)31-22-12-19(3-4-20(22)23)26(33)28-15-17-6-8-32-24(11-17)29-16-30-32/h3-8,11-14,16H,9-10,15H2,1-2H3,(H,28,33) |
| InChIKey | AQYSTTSHPDHQLA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|