C24H24FN5O3 — CID 122431456
4-ethoxy-2-(5-fluoro-2-methoxyphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide (PubChem CID 122431456) has the molecular formula C24H24FN5O3 and a molecular weight of 449.49 g/mol. Its IUPAC name is 4-ethoxy-2-(5-fluoro-2-methoxyphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-(5-fluoro-2-methoxyphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431456 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 4-ethoxy-2-(5-fluoro-2-methoxyphenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2cc(F)ccc2OC)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C24H24FN5O3/c1-3-33-22-13-20(18-12-16(25)7-9-21(18)32-2)29-19-11-15(6-8-17(19)22)24(31)26-10-4-5-23-27-14-28-30-23/h6-9,11-14H,3-5,10H2,1-2H3,(H,26,31)(H,27,28,30) |
| InChIKey | QKHFAOLDHRVDRP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|