C23H23N5O2 — CID 122431459
4-ethoxy-2-phenyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide (PubChem CID 122431459) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-ethoxy-2-phenyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-phenyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431459 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 4-ethoxy-2-phenyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2ccccc2)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C23H23N5O2/c1-2-30-21-14-19(16-7-4-3-5-8-16)27-20-13-17(10-11-18(20)21)23(29)24-12-6-9-22-25-15-26-28-22/h3-5,7-8,10-11,13-15H,2,6,9,12H2,1H3,(H,24,29)(H,25,26,28) |
| InChIKey | CHZXKJJDHJFYPF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|