C22H22N6O2 — CID 122431470
4-ethoxy-2-pyridin-4-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide (PubChem CID 122431470) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-ethoxy-2-pyridin-4-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-pyridin-4-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431470 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-ethoxy-2-pyridin-4-yl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2ccncc2)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C22H22N6O2/c1-2-30-20-13-18(15-7-10-23-11-8-15)27-19-12-16(5-6-17(19)20)22(29)24-9-3-4-21-25-14-26-28-21/h5-8,10-14H,2-4,9H2,1H3,(H,24,29)(H,25,26,28) |
| InChIKey | ZRLPCUDIBNMCIX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|