C23H21F3N6O2 — CID 122431582
4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[2-(trifluoromethyl)-4-pyridinyl]quinoline-7-carboxamide (PubChem CID 122431582) has the molecular formula C23H21F3N6O2 and a molecular weight of 470.46 g/mol. Its IUPAC name is 4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[2-(trifluoromethyl)-4-pyridinyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[2-(trifluoromethyl)-4-pyridinyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431582 |
| Molecular Formula | C23H21F3N6O2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-2-[2-(trifluoromethyl)-4-pyridinyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2ccnc(C(F)(F)F)c2)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C23H21F3N6O2/c1-2-34-19-12-17(14-7-9-27-20(11-14)23(24,25)26)31-18-10-15(5-6-16(18)19)22(33)28-8-3-4-21-29-13-30-32-21/h5-7,9-13H,2-4,8H2,1H3,(H,28,33)(H,29,30,32) |
| InChIKey | VJONLVZIPNPMEN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|