C23H23FN6O3 — CID 122431583
4-ethoxy-2-(5-fluoro-2-methoxy-4-pyridinyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide (PubChem CID 122431583) has the molecular formula C23H23FN6O3 and a molecular weight of 450.47 g/mol. Its IUPAC name is 4-ethoxy-2-(5-fluoro-2-methoxy-4-pyridinyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide.
| Compound Name | 4-ethoxy-2-(5-fluoro-2-methoxy-4-pyridinyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 122431583 |
| Molecular Formula | C23H23FN6O3 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-ethoxy-2-(5-fluoro-2-methoxy-4-pyridinyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]quinoline-7-carboxamide |
| SMILES | CCOc1cc(-c2cc(OC)ncc2F)nc2cc(C(=O)NCCCc3ncn[nH]3)ccc12 |
| InChI | InChI=1S/C23H23FN6O3/c1-3-33-20-11-19(16-10-22(32-2)26-12-17(16)24)29-18-9-14(6-7-15(18)20)23(31)25-8-4-5-21-27-13-28-30-21/h6-7,9-13H,3-5,8H2,1-2H3,(H,25,31)(H,27,28,30) |
| InChIKey | UYQGXKQTCWJSQL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|