C8H6FN3O — CID 122431705
7-fluoro-3-methyl-1,2,3-benzotriazin-4-one (PubChem CID 122431705) has the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. Its IUPAC name is 7-fluoro-3-methyl-1,2,3-benzotriazin-4-one.
| Compound Name | 7-fluoro-3-methyl-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 122431705 |
| Molecular Formula | C8H6FN3O |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 7-fluoro-3-methyl-1,2,3-benzotriazin-4-one |
| SMILES | Cn1nnc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C8H6FN3O/c1-12-8(13)6-3-2-5(9)4-7(6)10-11-12/h2-4H,1H3 |
| InChIKey | SMMHJMKUVAVPQZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |