C22H28N6O4S — CID 122432521
N-(methoxymethyl)-1-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-3-carboxamide (PubChem CID 122432521) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-(methoxymethyl)-1-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-3-carboxamide.
| Compound Name | N-(methoxymethyl)-1-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 122432521 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-(methoxymethyl)-1-[methyl-[7-(4-methylphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-4-yl]amino]piperidine-3-carboxamide |
| SMILES | COCNC(=O)C1CCCN(N(C)c2ncnc3c2ccn3S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H28N6O4S/c1-16-6-8-18(9-7-16)33(30,31)28-12-10-19-20(23-14-24-21(19)28)26(2)27-11-4-5-17(13-27)22(29)25-15-32-3/h6-10,12,14,17H,4-5,11,13,15H2,1-3H3,(H,25,29) |
| InChIKey | WFVGSXLBPSMCFI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|