C32H31N3O7 — CID 122432871
3,4,5-trimethoxy-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3,4,5-trimethoxyphenyl)aniline (PubChem CID 122432871) has the molecular formula C32H31N3O7 and a molecular weight of 569.61 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3,4,5-trimethoxyphenyl)aniline.
| Compound Name | 3,4,5-trimethoxy-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3,4,5-trimethoxyphenyl)aniline |
|---|---|
| PubChem CID | 122432871 |
| Molecular Formula | C32H31N3O7 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3,4,5-trimethoxyphenyl)aniline |
| SMILES | COc1cc(N(c2cc(OC)c(OC)c(OC)c2)c2ccccc2-c2nnc(-c3ccccc3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C32H31N3O7/c1-36-25-16-21(17-26(37-2)29(25)40-5)35(22-18-27(38-3)30(41-6)28(19-22)39-4)24-15-11-10-14-23(24)32-34-33-31(42-32)20-12-8-7-9-13-20/h7-19H,1-6H3 |
| InChIKey | UQLKSCIZGMSESI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 97.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |