About (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile
(2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile (PubChem CID 122433488) has the molecular formula C18H19N3
and a molecular weight of 277.37 g/mol. Its IUPAC name is (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile.
Molecular Properties
| Compound Name | (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile |
| PubChem CID | 122433488 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile |
| SMILES | Cc1cccc(C)c1N1c2cc(C#N)ccc2N(C)[C@@H]1C |
| InChI | InChI=1S/C18H19N3/c1-12-6-5-7-13(2)18(12)21-14(3)20(4)16-9-8-15(11-19)10-17(16)21/h5-10,14H,1-4H3/t14-/m0/s1 |
| InChIKey | CMIMEXQKMKPDAM-AWEZNQCLSA-N |
| XLogP | 4.11 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile?
The IUPAC name of (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile (CID 122433488) is (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile.
What is the SMILES notation for (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile?
The canonical SMILES for (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile is Cc1cccc(C)c1N1c2cc(C#N)ccc2N(C)[C@@H]1C.
What is the InChIKey of (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile?
The InChIKey is CMIMEXQKMKPDAM-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H19N3/c1-12-6-5-7-13(2)18(12)21-14(3)20(4)16-9-8-15(11-19)10-17(16)21/h5-10,14H,1-4H3/t14-/m0/s1.
What are the key properties of (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile?
(2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile has a molecular weight of 277.37 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2,6-dimethylphenyl)-1,2-dimethyl-2H-benzimidazole-5-carbonitrile is sourced from PubChem (CID 122433488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).