C57H67N3O2 — CID 122434078
[2-[[4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 122434078) has the molecular formula C57H67N3O2 and a molecular weight of 826.18 g/mol. Its IUPAC name is [2-[[4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122434078 |
| Molecular Formula | C57H67N3O2 |
| Molecular Weight | 826.18 g/mol |
| Exact Mass | 825.52 |
| IUPAC Name | [2-[[4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1Nc1ccc(C(c2ccc(N(CCC)c3c(C)cc(C)cc3C)cc2)c2ccc(N(CCC)c3c(C)cc(C)cc3C)cc2)c2ccccc12 |
| InChI | InChI=1S/C57H67N3O2/c1-11-31-59(55-40(7)33-38(5)34-41(55)8)46-25-21-44(22-26-46)54(45-23-27-47(28-24-45)60(32-12-2)56-42(9)35-39(6)36-43(56)10)50-29-30-51(49-18-14-13-17-48(49)50)58-52-19-15-16-20-53(52)62-57(61)37(3)4/h13-14,17-18,21-30,33-36,52-54,58H,3,11-12,15-16,19-20,31-32H2,1-2,4-10H3 |
| InChIKey | WSIHNTPVHVNCIU-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.18 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|