C50H55N3O2 — CID 122434084
2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]propyl 2-methylprop-2-enoate (PubChem CID 122434084) has the molecular formula C50H55N3O2 and a molecular weight of 730.01 g/mol. Its IUPAC name is 2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122434084 |
| Molecular Formula | C50H55N3O2 |
| Molecular Weight | 730.01 g/mol |
| Exact Mass | 729.43 |
| IUPAC Name | 2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)Nc1ccc(C(c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccccc12 |
| InChI | InChI=1S/C50H55N3O2/c1-31(2)50(54)55-30-38(9)51-46-25-24-45(43-14-12-13-15-44(43)46)47(39-16-20-41(21-17-39)52(10)48-34(5)26-32(3)27-35(48)6)40-18-22-42(23-19-40)53(11)49-36(7)28-33(4)29-37(49)8/h12-29,38,47,51H,1,30H2,2-11H3 |
| InChIKey | FSONMXYHIDEKPN-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.01 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|