C53H59N3O2 — CID 122434085
[2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 122434085) has the molecular formula C53H59N3O2 and a molecular weight of 770.07 g/mol. Its IUPAC name is [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122434085 |
| Molecular Formula | C53H59N3O2 |
| Molecular Weight | 770.07 g/mol |
| Exact Mass | 769.46 |
| IUPAC Name | [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1Nc1ccc(C(c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccccc12 |
| InChI | InChI=1S/C53H59N3O2/c1-33(2)53(57)58-49-18-14-13-17-48(49)54-47-28-27-46(44-15-11-12-16-45(44)47)50(40-19-23-42(24-20-40)55(9)51-36(5)29-34(3)30-37(51)6)41-21-25-43(26-22-41)56(10)52-38(7)31-35(4)32-39(52)8/h11-12,15-16,19-32,48-50,54H,1,13-14,17-18H2,2-10H3 |
| InChIKey | WRGZHYQDWFMXFU-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.07 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|