C51H57N3O2 — CID 122434086
[2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 122434086) has the molecular formula C51H57N3O2 and a molecular weight of 744.04 g/mol. Its IUPAC name is [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122434086 |
| Molecular Formula | C51H57N3O2 |
| Molecular Weight | 744.04 g/mol |
| Exact Mass | 743.45 |
| IUPAC Name | [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)Nc1ccc(C(c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccccc12 |
| InChI | InChI=1S/C51H57N3O2/c1-32(2)50(55)56-31-51(9,10)52-46-26-25-45(43-15-13-14-16-44(43)46)47(39-17-21-41(22-18-39)53(11)48-35(5)27-33(3)28-36(48)6)40-19-23-42(24-20-40)54(12)49-37(7)29-34(4)30-38(49)8/h13-30,47,52H,1,31H2,2-12H3 |
| InChIKey | WEFIGOIKSTYOPJ-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.04 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|