C59H71N3O2 — CID 122434087
[2-[[4-[bis[4-(2,6-diethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 122434087) has the molecular formula C59H71N3O2 and a molecular weight of 854.24 g/mol. Its IUPAC name is [2-[[4-[bis[4-(2,6-diethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[bis[4-(2,6-diethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122434087 |
| Molecular Formula | C59H71N3O2 |
| Molecular Weight | 854.24 g/mol |
| Exact Mass | 853.55 |
| IUPAC Name | [2-[[4-[bis[4-(2,6-diethyl-N-propylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCCC1Nc1ccc(C(c2ccc(N(CCC)c3c(CC)cccc3CC)cc2)c2ccc(N(CCC)c3c(CC)cccc3CC)cc2)c2ccccc12 |
| InChI | InChI=1S/C59H71N3O2/c1-9-39-61(57-42(11-3)21-19-22-43(57)12-4)48-33-29-46(30-34-48)56(47-31-35-49(36-32-47)62(40-10-2)58-44(13-5)23-20-24-45(58)14-6)52-37-38-53(51-26-16-15-25-50(51)52)60-54-27-17-18-28-55(54)64-59(63)41(7)8/h15-16,19-26,29-38,54-56,60H,7,9-14,17-18,27-28,39-40H2,1-6,8H3 |
| InChIKey | XVJPGROFACWXSH-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.24 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|