C22H30N2O6 — CID 122434844
[(1S,2S)-2-[(2R)-2-(4-methylcyclohexyl)propyl]cyclopentyl] 3,5-dinitrobenzoate (PubChem CID 122434844) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is [(1S,2S)-2-[(2R)-2-(4-methylcyclohexyl)propyl]cyclopentyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2S)-2-[(2R)-2-(4-methylcyclohexyl)propyl]cyclopentyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 122434844 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(1S,2S)-2-[(2R)-2-(4-methylcyclohexyl)propyl]cyclopentyl] 3,5-dinitrobenzoate |
| SMILES | CC1CCC([C@H](C)C[C@@H]2CCC[C@@H]2OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H30N2O6/c1-14-6-8-16(9-7-14)15(2)10-17-4-3-5-21(17)30-22(25)18-11-19(23(26)27)13-20(12-18)24(28)29/h11-17,21H,3-10H2,1-2H3/t14?,15-,16?,17+,21+/m1/s1 |
| InChIKey | MTNYQTNAUBXXSX-FXWDYJHDSA-N |
| XLogP | 5.68 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|