C19H18F2N6O2S — CID 122435132
(5R)-5-[2-fluoro-5-[(3-fluoro-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 122435132) has the molecular formula C19H18F2N6O2S and a molecular weight of 432.46 g/mol. Its IUPAC name is (5R)-5-[2-fluoro-5-[(3-fluoro-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[2-fluoro-5-[(3-fluoro-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 122435132 |
| Molecular Formula | C19H18F2N6O2S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (5R)-5-[2-fluoro-5-[(3-fluoro-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(Nc3nccc4cc(F)cnc34)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H18F2N6O2S/c1-19(10-30(28,29)27(2)18(22)26-19)14-8-13(3-4-15(14)21)25-17-16-11(5-6-23-17)7-12(20)9-24-16/h3-9H,10H2,1-2H3,(H2,22,26)(H,23,25)/t19-/m0/s1 |
| InChIKey | ILDBHCXYFTUYOS-IBGZPJMESA-N |
| XLogP | 2.46 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |