C20H21FN6O3S — CID 122435134
(5R)-5-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 122435134) has the molecular formula C20H21FN6O3S and a molecular weight of 444.49 g/mol. Its IUPAC name is (5R)-5-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 122435134 |
| Molecular Formula | C20H21FN6O3S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (5R)-5-[2-fluoro-5-[(3-methoxy-1,7-naphthyridin-8-yl)amino]phenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | COc1cnc2c(Nc3ccc(F)c([C@]4(C)CS(=O)(=O)N(C)C(N)=N4)c3)nccc2c1 |
| InChI | InChI=1S/C20H21FN6O3S/c1-20(11-31(28,29)27(2)19(22)26-20)15-9-13(4-5-16(15)21)25-18-17-12(6-7-23-18)8-14(30-3)10-24-17/h4-10H,11H2,1-3H3,(H2,22,26)(H,23,25)/t20-/m0/s1 |
| InChIKey | QBRFLMCPVOBSGI-FQEVSTJZSA-N |
| XLogP | 2.33 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |