C19H21ClFN5O2S — CID 122435135
(5R)-5-[5-[[(5R)-3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]amino]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 122435135) has the molecular formula C19H21ClFN5O2S and a molecular weight of 437.93 g/mol. Its IUPAC name is (5R)-5-[5-[[(5R)-3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]amino]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5R)-5-[5-[[(5R)-3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]amino]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 122435135 |
| Molecular Formula | C19H21ClFN5O2S |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | (5R)-5-[5-[[(5R)-3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl]amino]-2-fluorophenyl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2cc(N[C@@H]3CCc4ncc(Cl)cc43)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C19H21ClFN5O2S/c1-19(10-29(27,28)26(2)18(22)25-19)14-8-12(3-4-15(14)21)24-17-6-5-16-13(17)7-11(20)9-23-16/h3-4,7-9,17,24H,5-6,10H2,1-2H3,(H2,22,25)/t17-,19+/m1/s1 |
| InChIKey | AWMWBVLHSLMMBZ-MJGOQNOKSA-N |
| XLogP | 2.78 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |