About 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one
2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one (PubChem CID 122435153) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one.
Molecular Properties
| Compound Name | 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one |
| PubChem CID | 122435153 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one |
| SMILES | COc1cnc2c(=O)[nH]ccc2n1 |
| InChI | InChI=1S/C8H7N3O2/c1-13-6-4-10-7-5(11-6)2-3-9-8(7)12/h2-4H,1H3,(H,9,12) |
| InChIKey | OSQGYRFLGMUGOE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one?
The IUPAC name of 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one (CID 122435153) is 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one.
What is the SMILES notation for 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one?
The canonical SMILES for 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one is COc1cnc2c(=O)[nH]ccc2n1.
What is the InChIKey of 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one?
The InChIKey is OSQGYRFLGMUGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c1-13-6-4-10-7-5(11-6)2-3-9-8(7)12/h2-4H,1H3,(H,9,12).
What are the key properties of 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one?
2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one has a molecular weight of 177.16 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6H-pyrido[3,4-b]pyrazin-5-one is sourced from PubChem (CID 122435153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).