C19H18N2O — CID 122435368
4-(1,2,3,4,4a,10a-hexahydrophenoxazin-10-yl)benzonitrile (PubChem CID 122435368) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-(1,2,3,4,4a,10a-hexahydrophenoxazin-10-yl)benzonitrile.
| Compound Name | 4-(1,2,3,4,4a,10a-hexahydrophenoxazin-10-yl)benzonitrile |
|---|---|
| PubChem CID | 122435368 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-(1,2,3,4,4a,10a-hexahydrophenoxazin-10-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2c3ccccc3OC3CCCCC32)cc1 |
| InChI | InChI=1S/C19H18N2O/c20-13-14-9-11-15(12-10-14)21-16-5-1-3-7-18(16)22-19-8-4-2-6-17(19)21/h1,3,5,7,9-12,17,19H,2,4,6,8H2 |
| InChIKey | CSAANEAZTIYQPY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |