About 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile
8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile (PubChem CID 122435484) has the molecular formula C32H26N2O2
and a molecular weight of 470.57 g/mol. Its IUPAC name is 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile.
Molecular Properties
| Compound Name | 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile |
| PubChem CID | 122435484 |
| Molecular Formula | C32H26N2O2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile |
| SMILES | COc1cccc(-c2ccccc2N(C)c2ccccc2-c2cccc3cccc(C#N)c23)c1OC |
| InChI | InChI=1S/C32H26N2O2/c1-34(29-19-7-5-15-25(29)27-17-10-20-30(35-2)32(27)36-3)28-18-6-4-14-24(28)26-16-9-12-22-11-8-13-23(21-33)31(22)26/h4-20H,1-3H3 |
| InChIKey | IMZQIPDEHSRBTK-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile?
The IUPAC name of 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile (CID 122435484) is 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile.
What is the SMILES notation for 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile?
The canonical SMILES for 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile is COc1cccc(-c2ccccc2N(C)c2ccccc2-c2cccc3cccc(C#N)c23)c1OC.
What is the InChIKey of 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile?
The InChIKey is IMZQIPDEHSRBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H26N2O2/c1-34(29-19-7-5-15-25(29)27-17-10-20-30(35-2)32(27)36-3)28-18-6-4-14-24(28)26-16-9-12-22-11-8-13-23(21-33)31(22)26/h4-20H,1-3H3.
What are the key properties of 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile?
8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile has a molecular weight of 470.57 g/mol, XLogP of 7.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-[2-(2,3-dimethoxyphenyl)-N-methylanilino]phenyl]naphthalene-1-carbonitrile is sourced from PubChem (CID 122435484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).