C9H12O2 — CID 122435793
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyacetaldehyde (PubChem CID 122435793) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyacetaldehyde.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyacetaldehyde |
|---|---|
| PubChem CID | 122435793 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyacetaldehyde |
| SMILES | C=C/C=C(\C=C/C)OCC=O |
| InChI | InChI=1S/C9H12O2/c1-3-5-9(6-4-2)11-8-7-10/h3-7H,1,8H2,2H3/b6-4-,9-5+ |
| InChIKey | WONDIQJPKWZINR-QUNSIMLLSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|