C60H39N7OS2 — CID 122435891
4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N,N-bis[4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl]aniline (PubChem CID 122435891) has the molecular formula C60H39N7OS2 and a molecular weight of 938.15 g/mol. Its IUPAC name is 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N,N-bis[4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl]aniline.
| Compound Name | 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N,N-bis[4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 122435891 |
| Molecular Formula | C60H39N7OS2 |
| Molecular Weight | 938.15 g/mol |
| Exact Mass | 937.27 |
| IUPAC Name | 4-[2-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-N,N-bis[4-[2-(5-phenyl-1,3,4-thiadiazol-2-yl)phenyl]phenyl]aniline |
| SMILES | c1ccc(-c2nnc(-c3ccccc3-c3ccc(N(c4ccc(-c5ccccc5-c5nnc(-c6ccccc6)s5)cc4)c4ccc(-c5ccccc5-c5nnc(-c6ccccc6)s5)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C60H39N7OS2/c1-4-16-43(17-5-1)55-61-62-56(68-55)52-25-13-10-22-49(52)40-28-34-46(35-29-40)67(47-36-30-41(31-37-47)50-23-11-14-26-53(50)59-65-63-57(69-59)44-18-6-2-7-19-44)48-38-32-42(33-39-48)51-24-12-15-27-54(51)60-66-64-58(70-60)45-20-8-3-9-21-45/h1-39H |
| InChIKey | FUXMYKRUXPGFQF-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 93.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.15 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |