About 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine
4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine (PubChem CID 122436316) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine |
| PubChem CID | 122436316 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine |
| SMILES | CC1(C)OCC(CN2CCOCC2)CO1 |
| InChI | InChI=1S/C11H21NO3/c1-11(2)14-8-10(9-15-11)7-12-3-5-13-6-4-12/h10H,3-9H2,1-2H3 |
| InChIKey | JEZOBGSDQMIBEQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine?
The IUPAC name of 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine (CID 122436316) is 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine.
What is the SMILES notation for 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine?
The canonical SMILES for 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine is CC1(C)OCC(CN2CCOCC2)CO1.
What is the InChIKey of 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine?
The InChIKey is JEZOBGSDQMIBEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-11(2)14-8-10(9-15-11)7-12-3-5-13-6-4-12/h10H,3-9H2,1-2H3.
What are the key properties of 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine?
4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine has a molecular weight of 215.29 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methyl]morpholine is sourced from PubChem (CID 122436316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).