C38H39F3N4O5 — CID 122436547
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide (PubChem CID 122436547) has the molecular formula C38H39F3N4O5 and a molecular weight of 688.75 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436547 |
| Molecular Formula | C38H39F3N4O5 |
| Molecular Weight | 688.75 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-[4-(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H39F3N4O5/c1-47-32-15-9-27(10-16-32)34-35(28-11-17-33(48-2)18-12-28)45(36(44-34)29-7-13-31(14-8-29)38(39,40)41)25-26-3-5-30(6-4-26)37(46)43-20-22-50-24-23-49-21-19-42/h3-18H,19-25,42H2,1-2H3,(H,43,46) |
| InChIKey | HFVMWCDZMPSSDE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|