C39H34F6N4O7 — CID 122436559
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(1,3-benzodioxol-5-yl)-2-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide (PubChem CID 122436559) has the molecular formula C39H34F6N4O7 and a molecular weight of 784.71 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(1,3-benzodioxol-5-yl)-2-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(1,3-benzodioxol-5-yl)-2-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436559 |
| Molecular Formula | C39H34F6N4O7 |
| Molecular Weight | 784.71 g/mol |
| Exact Mass | 784.23 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(1,3-benzodioxol-5-yl)-2-[3,5-bis(trifluoromethyl)phenyl]imidazol-1-yl]methyl]benzamide |
| SMILES | NCCOCCOCCNC(=O)c1ccc(Cn2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc(-c3ccc4c(c3)OCO4)c2-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C39H34F6N4O7/c40-38(41,42)28-15-27(16-29(19-28)39(43,44)45)36-48-34(25-5-7-30-32(17-25)55-21-53-30)35(26-6-8-31-33(18-26)56-22-54-31)49(36)20-23-1-3-24(4-2-23)37(50)47-10-12-52-14-13-51-11-9-46/h1-8,15-19H,9-14,20-22,46H2,(H,47,50) |
| InChIKey | XYMGASJQFDJTGO-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|