C41H42F6N4O7 — CID 122436575
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3,4-dimethoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436575) has the molecular formula C41H42F6N4O7 and a molecular weight of 816.80 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3,4-dimethoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3,4-dimethoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436575 |
| Molecular Formula | C41H42F6N4O7 |
| Molecular Weight | 816.80 g/mol |
| Exact Mass | 816.30 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3,4-dimethoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C41H42F6N4O7/c1-53-32-13-9-27(21-34(32)55-3)36-37(28-10-14-33(54-2)35(22-28)56-4)51(38(50-36)30-12-11-29(40(42,43)44)23-31(30)41(45,46)47)24-25-5-7-26(8-6-25)39(52)49-16-18-58-20-19-57-17-15-48/h5-14,21-23H,15-20,24,48H2,1-4H3,(H,49,52) |
| InChIKey | PZJIJKKCWHWTGA-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.80 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|