C40H44F2N4O8 — CID 122436579
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436579) has the molecular formula C40H44F2N4O8 and a molecular weight of 746.81 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436579 |
| Molecular Formula | C40H44F2N4O8 |
| Molecular Weight | 746.81 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(3-fluoro-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(-c3cc(OC)c(OC)c(OC)c3)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2-c2ccc(OC)c(F)c2)cc1F |
| InChI | InChI=1S/C40H44F2N4O8/c1-48-32-12-10-27(20-30(32)41)36-37(28-11-13-33(49-2)31(42)21-28)46(39(45-36)29-22-34(50-3)38(52-5)35(23-29)51-4)24-25-6-8-26(9-7-25)40(47)44-15-17-54-19-18-53-16-14-43/h6-13,20-23H,14-19,24,43H2,1-5H3,(H,44,47) |
| InChIKey | SDVXDPLARDUVGI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.81 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|