C37H32Cl2F6N4O3 — CID 122436619
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(4-chlorophenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436619) has the molecular formula C37H32Cl2F6N4O3 and a molecular weight of 765.58 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(4-chlorophenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(4-chlorophenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436619 |
| Molecular Formula | C37H32Cl2F6N4O3 |
| Molecular Weight | 765.58 g/mol |
| Exact Mass | 764.18 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(4-chlorophenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | NCCOCCOCCNC(=O)c1ccc(Cn2c(-c3ccc(C(F)(F)F)cc3C(F)(F)F)nc(-c3ccc(Cl)cc3)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C37H32Cl2F6N4O3/c38-28-10-5-24(6-11-28)32-33(25-7-12-29(39)13-8-25)49(34(48-32)30-14-9-27(36(40,41)42)21-31(30)37(43,44)45)22-23-1-3-26(4-2-23)35(50)47-16-18-52-20-19-51-17-15-46/h1-14,21H,15-20,22,46H2,(H,47,50) |
| InChIKey | CCPCHCNYFTWZOO-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.58 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|