C39H38F6N4O5 — CID 122436663
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436663) has the molecular formula C39H38F6N4O5 and a molecular weight of 756.74 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436663 |
| Molecular Formula | C39H38F6N4O5 |
| Molecular Weight | 756.74 g/mol |
| Exact Mass | 756.27 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-[2,4-bis(trifluoromethyl)phenyl]-4,5-bis(3-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1cccc(-c2nc(-c3ccc(C(F)(F)F)cc3C(F)(F)F)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2-c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C39H38F6N4O5/c1-51-30-7-3-5-27(21-30)34-35(28-6-4-8-31(22-28)52-2)49(36(48-34)32-14-13-29(38(40,41)42)23-33(32)39(43,44)45)24-25-9-11-26(12-10-25)37(50)47-16-18-54-20-19-53-17-15-46/h3-14,21-23H,15-20,24,46H2,1-2H3,(H,47,50) |
| InChIKey | MQVFICCWVGPAQV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|