C39H42F2N4O7 — CID 122436673
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436673) has the molecular formula C39H42F2N4O7 and a molecular weight of 716.78 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436673 |
| Molecular Formula | C39H42F2N4O7 |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(2-fluoro-4-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1cc(OC)cc(-c2nc(-c3ccc(OC)cc3F)c(-c3ccc(OC)cc3F)n2Cc2ccc(C(=O)NCCOCCOCCN)cc2)c1 |
| InChI | InChI=1S/C39H42F2N4O7/c1-47-28-9-11-32(34(40)22-28)36-37(33-12-10-29(48-2)23-35(33)41)45(38(44-36)27-19-30(49-3)21-31(20-27)50-4)24-25-5-7-26(8-6-25)39(46)43-14-16-52-18-17-51-15-13-42/h5-12,19-23H,13-18,24,42H2,1-4H3,(H,43,46) |
| InChIKey | XXLSCINEKBKBRX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|