C38H40F2N4O6 — CID 122436720
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436720) has the molecular formula C38H40F2N4O6 and a molecular weight of 686.76 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436720 |
| Molecular Formula | C38H40F2N4O6 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.29 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-fluorophenyl)-2-(3,4,5-trimethoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1cc(-c2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n2Cc2ccc(C(=O)NCCOCCOCCN)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C38H40F2N4O6/c1-46-32-22-29(23-33(47-2)36(32)48-3)37-43-34(26-8-12-30(39)13-9-26)35(27-10-14-31(40)15-11-27)44(37)24-25-4-6-28(7-5-25)38(45)42-17-19-50-21-20-49-18-16-41/h4-15,22-23H,16-21,24,41H2,1-3H3,(H,42,45) |
| InChIKey | NSBDYZKDLRWDHJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|