C39H38N6O5 — CID 122436734
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dicyanophenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436734) has the molecular formula C39H38N6O5 and a molecular weight of 670.77 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dicyanophenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dicyanophenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436734 |
| Molecular Formula | C39H38N6O5 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.29 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dicyanophenyl)-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(-c3cc(C#N)cc(C#N)c3)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H38N6O5/c1-47-34-11-7-30(8-12-34)36-37(31-9-13-35(48-2)14-10-31)45(38(44-36)33-22-28(24-41)21-29(23-33)25-42)26-27-3-5-32(6-4-27)39(46)43-16-18-50-20-19-49-17-15-40/h3-14,21-23H,15-20,26,40H2,1-2H3,(H,43,46) |
| InChIKey | HCQXLYHPDBPFBA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 157.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|