C24H31N3O7S — CID 122436863
(2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)-2-(4-sulfamoylphenyl)piperidine-2-carboxylic acid (PubChem CID 122436863) has the molecular formula C24H31N3O7S and a molecular weight of 505.59 g/mol. Its IUPAC name is (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)-2-(4-sulfamoylphenyl)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)-2-(4-sulfamoylphenyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122436863 |
| Molecular Formula | C24H31N3O7S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxyamino)-2-(4-sulfamoylphenyl)piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NOCc2ccccc2)CC[C@@]1(C(=O)O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H31N3O7S/c1-23(2,3)34-22(30)27-15-19(26-33-16-17-7-5-4-6-8-17)13-14-24(27,21(28)29)18-9-11-20(12-10-18)35(25,31)32/h4-12,19,26H,13-16H2,1-3H3,(H,28,29)(H2,25,31,32)/t19-,24+/m1/s1 |
| InChIKey | STFTYPNSXPQACM-DVECYGJZSA-N |
| XLogP | 2.73 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|