C26H24Cl3F5N2O7 — CID 122436886
(2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid (PubChem CID 122436886) has the molecular formula C26H24Cl3F5N2O7 and a molecular weight of 677.83 g/mol. Its IUPAC name is (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122436886 |
| Molecular Formula | C26H24Cl3F5N2O7 |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 676.06 |
| IUPAC Name | (2S,5R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CC[C@@]1(C(=O)O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H24Cl3F5N2O7/c1-24(2,3)42-22(39)35-11-14(36(23(40)43-26(27,28)29)41-12-13-7-5-4-6-8-13)9-10-25(35,21(37)38)15-16(30)18(32)20(34)19(33)17(15)31/h4-8,14H,9-12H2,1-3H3,(H,37,38)/t14-,25+/m1/s1 |
| InChIKey | DKEDMSZQYZSEFR-PWECECGKSA-N |
| XLogP | 6.96 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|