C26H31ClN2O8S — CID 122436953
(2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-methylsulfonylphenyl)piperidine-2-carboxylic acid (PubChem CID 122436953) has the molecular formula C26H31ClN2O8S and a molecular weight of 567.06 g/mol. Its IUPAC name is (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-methylsulfonylphenyl)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-methylsulfonylphenyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122436953 |
| Molecular Formula | C26H31ClN2O8S |
| Molecular Weight | 567.06 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-methylsulfonylphenyl)piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)Cl)CC[C@@]1(C(=O)O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H31ClN2O8S/c1-25(2,3)37-24(33)28-16-20(29(23(27)32)36-17-18-8-6-5-7-9-18)14-15-26(28,22(30)31)19-10-12-21(13-11-19)38(4,34)35/h5-13,20H,14-17H2,1-4H3,(H,30,31)/t20-,26+/m1/s1 |
| InChIKey | GCTFZCFQMVRERR-IBVKSMDESA-N |
| XLogP | 4.56 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.06 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|