C34H36F2N6O4S — CID 122437492
4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-diethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate (PubChem CID 122437492) has the molecular formula C34H36F2N6O4S and a molecular weight of 662.76 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-diethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate.
| Compound Name | 4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-diethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate |
|---|---|
| PubChem CID | 122437492 |
| Molecular Formula | C34H36F2N6O4S |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-diethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate |
| SMILES | CCN1CCN(CC)C(c2ccc(Nc3nc(-c4ccc(F)c(NC(=O)Oc5cc6c(s5)CCCC6)c4F)cn(C)c3=O)cc2)C1=O |
| InChI | InChI=1S/C34H36F2N6O4S/c1-4-41-16-17-42(5-2)32(43)30(41)20-10-12-22(13-11-20)37-31-33(44)40(3)19-25(38-31)23-14-15-24(35)29(28(23)36)39-34(45)46-27-18-21-8-6-7-9-26(21)47-27/h10-15,18-19,30H,4-9,16-17H2,1-3H3,(H,37,38)(H,39,45) |
| InChIKey | OYDDTACDLGVNET-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |