C32H32F2N6O4S — CID 122437499
4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate (PubChem CID 122437499) has the molecular formula C32H32F2N6O4S and a molecular weight of 634.71 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate.
| Compound Name | 4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate |
|---|---|
| PubChem CID | 122437499 |
| Molecular Formula | C32H32F2N6O4S |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophen-2-yl N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2,6-difluorophenyl]carbamate |
| SMILES | CN1CCN(C)C(c2ccc(Nc3nc(-c4ccc(F)c(NC(=O)Oc5cc6c(s5)CCCC6)c4F)cn(C)c3=O)cc2)C1=O |
| InChI | InChI=1S/C32H32F2N6O4S/c1-38-14-15-39(2)30(41)28(38)18-8-10-20(11-9-18)35-29-31(42)40(3)17-23(36-29)21-12-13-22(33)27(26(21)34)37-32(43)44-25-16-19-6-4-5-7-24(19)45-25/h8-13,16-17,28H,4-7,14-15H2,1-3H3,(H,35,36)(H,37,43) |
| InChIKey | CFHYLKADIYJMPH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |